C12H24O8S2 — CID 10338580
[(2R,3R)-2-methyl-4-methylsulfonyloxy-3-(oxan-2-yloxy)butyl] methanesulfonate (PubChem CID 10338580) has the molecular formula C12H24O8S2 and a molecular weight of 360.45 g/mol. Its IUPAC name is [(2R,3R)-2-methyl-4-methylsulfonyloxy-3-(oxan-2-yloxy)butyl] methanesulfonate.
| Compound Name | [(2R,3R)-2-methyl-4-methylsulfonyloxy-3-(oxan-2-yloxy)butyl] methanesulfonate |
|---|---|
| PubChem CID | 10338580 |
| Molecular Formula | C12H24O8S2 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | [(2R,3R)-2-methyl-4-methylsulfonyloxy-3-(oxan-2-yloxy)butyl] methanesulfonate |
| SMILES | C[C@H](COS(C)(=O)=O)[C@H](COS(C)(=O)=O)OC1CCCCO1 |
| InChI | InChI=1S/C12H24O8S2/c1-10(8-18-21(2,13)14)11(9-19-22(3,15)16)20-12-6-4-5-7-17-12/h10-12H,4-9H2,1-3H3/t10-,11+,12?/m1/s1 |
| InChIKey | NJMIRYMQHBHQLA-UBNQGINQSA-N |
| XLogP | 0.49 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|