C20H34O8 — CID 169311786
2-[1,3,4-tris(oxolan-2-yloxy)butan-2-yloxy]oxolane (PubChem CID 169311786) has the molecular formula C20H34O8 and a molecular weight of 402.48 g/mol. Its IUPAC name is 2-[1,3,4-tris(oxolan-2-yloxy)butan-2-yloxy]oxolane.
| Compound Name | 2-[1,3,4-tris(oxolan-2-yloxy)butan-2-yloxy]oxolane |
|---|---|
| PubChem CID | 169311786 |
| Molecular Formula | C20H34O8 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 2-[1,3,4-tris(oxolan-2-yloxy)butan-2-yloxy]oxolane |
| SMILES | C1COC(OCC(OC2CCCO2)C(COC2CCCO2)OC2CCCO2)C1 |
| InChI | InChI=1S/C20H34O8/c1-5-17(21-9-1)25-13-15(27-19-7-3-11-23-19)16(28-20-8-4-12-24-20)14-26-18-6-2-10-22-18/h15-20H,1-14H2 |
| InChIKey | XKFJIOZHOOURDX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |