C7H8Br6O2 — CID 18927784
2-(1,1,1,3,3,3-hexabromopropan-2-yloxy)oxolane (PubChem CID 18927784) has the molecular formula C7H8Br6O2 and a molecular weight of 603.56 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexabromopropan-2-yloxy)oxolane.
| Compound Name | 2-(1,1,1,3,3,3-hexabromopropan-2-yloxy)oxolane |
|---|---|
| PubChem CID | 18927784 |
| Molecular Formula | C7H8Br6O2 |
| Molecular Weight | 603.56 g/mol |
| Exact Mass | 597.56 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexabromopropan-2-yloxy)oxolane |
| SMILES | BrC(Br)(Br)C(OC1CCCO1)C(Br)(Br)Br |
| InChI | InChI=1S/C7H8Br6O2/c8-6(9,10)5(7(11,12)13)15-4-2-1-3-14-4/h4-5H,1-3H2 |
| InChIKey | RDHXQZNJKIANJO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|