C11H20O2 — CID 58329904
2-[(Z,2S)-hex-3-en-2-yl]oxyoxane (PubChem CID 58329904) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-[(Z,2S)-hex-3-en-2-yl]oxyoxane.
| Compound Name | 2-[(Z,2S)-hex-3-en-2-yl]oxyoxane |
|---|---|
| PubChem CID | 58329904 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 2-[(Z,2S)-hex-3-en-2-yl]oxyoxane |
| SMILES | CC/C=C\[C@H](C)OC1CCCCO1 |
| InChI | InChI=1S/C11H20O2/c1-3-4-7-10(2)13-11-8-5-6-9-12-11/h4,7,10-11H,3,5-6,8-9H2,1-2H3/b7-4-/t10-,11?/m0/s1 |
| InChIKey | NMWLNDPEEWXFPA-QQWGWAMQSA-N |
| XLogP | 2.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|