C16H30O2 — CID 102392953
2-[(E,2S,8R)-8-methyldec-6-en-2-yl]oxyoxane (PubChem CID 102392953) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is 2-[(E,2S,8R)-8-methyldec-6-en-2-yl]oxyoxane.
| Compound Name | 2-[(E,2S,8R)-8-methyldec-6-en-2-yl]oxyoxane |
|---|---|
| PubChem CID | 102392953 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 2-[(E,2S,8R)-8-methyldec-6-en-2-yl]oxyoxane |
| SMILES | CC[C@@H](C)/C=C/CCC[C@H](C)OC1CCCCO1 |
| InChI | InChI=1S/C16H30O2/c1-4-14(2)10-6-5-7-11-15(3)18-16-12-8-9-13-17-16/h6,10,14-16H,4-5,7-9,11-13H2,1-3H3/b10-6+/t14-,15+,16?/m1/s1 |
| InChIKey | SEDNBXMNWSDHLB-XUXUOXIDSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|