C22H38O5 — CID 102126737
(E)-2,12-bis(oxan-2-yloxy)dodec-10-en-6-one (PubChem CID 102126737) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is (E)-2,12-bis(oxan-2-yloxy)dodec-10-en-6-one.
| Compound Name | (E)-2,12-bis(oxan-2-yloxy)dodec-10-en-6-one |
|---|---|
| PubChem CID | 102126737 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | (E)-2,12-bis(oxan-2-yloxy)dodec-10-en-6-one |
| SMILES | CC(CCCC(=O)CCC/C=C/COC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C22H38O5/c1-19(27-22-15-6-9-18-26-22)11-10-13-20(23)12-4-2-3-7-16-24-21-14-5-8-17-25-21/h3,7,19,21-22H,2,4-6,8-18H2,1H3/b7-3+ |
| InChIKey | JTXVODMQEPBJAJ-XVNBXDOJSA-N |
| XLogP | 4.93 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|