C12H20I2O2 — CID 45278178
2-[(E)-7,7-diiodohept-2-enoxy]oxane (PubChem CID 45278178) has the molecular formula C12H20I2O2 and a molecular weight of 450.10 g/mol. Its IUPAC name is 2-[(E)-7,7-diiodohept-2-enoxy]oxane.
| Compound Name | 2-[(E)-7,7-diiodohept-2-enoxy]oxane |
|---|---|
| PubChem CID | 45278178 |
| Molecular Formula | C12H20I2O2 |
| Molecular Weight | 450.10 g/mol |
| Exact Mass | 449.96 |
| IUPAC Name | 2-[(E)-7,7-diiodohept-2-enoxy]oxane |
| SMILES | IC(I)CCC/C=C/COC1CCCCO1 |
| InChI | InChI=1S/C12H20I2O2/c13-11(14)7-3-1-2-5-9-15-12-8-4-6-10-16-12/h2,5,11-12H,1,3-4,6-10H2/b5-2+ |
| InChIKey | CMUWIYPTZCLEID-GORDUTHDSA-N |
| XLogP | 4.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.10 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|