C14H24I2O2 — CID 101499788
2-[(E)-8,8-diiodo-2-methyloct-2-enoxy]oxane (PubChem CID 101499788) has the molecular formula C14H24I2O2 and a molecular weight of 478.15 g/mol. Its IUPAC name is 2-[(E)-8,8-diiodo-2-methyloct-2-enoxy]oxane.
| Compound Name | 2-[(E)-8,8-diiodo-2-methyloct-2-enoxy]oxane |
|---|---|
| PubChem CID | 101499788 |
| Molecular Formula | C14H24I2O2 |
| Molecular Weight | 478.15 g/mol |
| Exact Mass | 477.99 |
| IUPAC Name | 2-[(E)-8,8-diiodo-2-methyloct-2-enoxy]oxane |
| SMILES | C/C(=C\CCCCC(I)I)COC1CCCCO1 |
| InChI | InChI=1S/C14H24I2O2/c1-12(7-3-2-4-8-13(15)16)11-18-14-9-5-6-10-17-14/h7,13-14H,2-6,8-11H2,1H3/b12-7+ |
| InChIKey | IEZGWLDEUZCAHR-KPKJPENVSA-N |
| XLogP | 5.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.15 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|