C14H26O3 — CID 25147334
(E,4R)-8-(oxan-2-yloxy)non-2-en-4-ol (PubChem CID 25147334) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is (E,4R)-8-(oxan-2-yloxy)non-2-en-4-ol.
| Compound Name | (E,4R)-8-(oxan-2-yloxy)non-2-en-4-ol |
|---|---|
| PubChem CID | 25147334 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | (E,4R)-8-(oxan-2-yloxy)non-2-en-4-ol |
| SMILES | C/C=C/[C@H](O)CCCC(C)OC1CCCCO1 |
| InChI | InChI=1S/C14H26O3/c1-3-7-13(15)9-6-8-12(2)17-14-10-4-5-11-16-14/h3,7,12-15H,4-6,8-11H2,1-2H3/b7-3+/t12?,13-,14?/m0/s1 |
| InChIKey | OXKXUWHMKAYRFW-HFRUYWQWSA-N |
| XLogP | 3.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|