C16H28O5 — CID 10913620
(E,2R,3S)-3,6-bis(oxan-2-yloxy)hex-4-en-2-ol (PubChem CID 10913620) has the molecular formula C16H28O5 and a molecular weight of 300.39 g/mol. Its IUPAC name is (E,2R,3S)-3,6-bis(oxan-2-yloxy)hex-4-en-2-ol.
| Compound Name | (E,2R,3S)-3,6-bis(oxan-2-yloxy)hex-4-en-2-ol |
|---|---|
| PubChem CID | 10913620 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (E,2R,3S)-3,6-bis(oxan-2-yloxy)hex-4-en-2-ol |
| SMILES | C[C@@H](O)[C@H](/C=C/COC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C16H28O5/c1-13(17)14(21-16-9-3-5-11-20-16)7-6-12-19-15-8-2-4-10-18-15/h6-7,13-17H,2-5,8-12H2,1H3/b7-6+/t13-,14+,15?,16?/m1/s1 |
| InChIKey | NBZWEQFTVDBEGD-SBMKEWFHSA-N |
| XLogP | 2.38 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|