C13H17BrO2 — CID 59069780
2-[(1R)-1-(2-bromophenyl)ethoxy]oxane (PubChem CID 59069780) has the molecular formula C13H17BrO2 and a molecular weight of 285.18 g/mol. Its IUPAC name is 2-[(1R)-1-(2-bromophenyl)ethoxy]oxane.
| Compound Name | 2-[(1R)-1-(2-bromophenyl)ethoxy]oxane |
|---|---|
| PubChem CID | 59069780 |
| Molecular Formula | C13H17BrO2 |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-[(1R)-1-(2-bromophenyl)ethoxy]oxane |
| SMILES | C[C@@H](OC1CCCCO1)c1ccccc1Br |
| InChI | InChI=1S/C13H17BrO2/c1-10(11-6-2-3-7-12(11)14)16-13-8-4-5-9-15-13/h2-3,6-7,10,13H,4-5,8-9H2,1H3/t10-,13?/m1/s1 |
| InChIKey | LQQTXQBTEFTGKG-VUUHIHSGSA-N |
| XLogP | 4.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |