C15H19NO3 — CID 175791848
2-[(2S)-2-(oxan-2-yloxy)propoxy]benzonitrile (PubChem CID 175791848) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-[(2S)-2-(oxan-2-yloxy)propoxy]benzonitrile.
| Compound Name | 2-[(2S)-2-(oxan-2-yloxy)propoxy]benzonitrile |
|---|---|
| PubChem CID | 175791848 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 2-[(2S)-2-(oxan-2-yloxy)propoxy]benzonitrile |
| SMILES | C[C@@H](COc1ccccc1C#N)OC1CCCCO1 |
| InChI | InChI=1S/C15H19NO3/c1-12(19-15-8-4-5-9-17-15)11-18-14-7-3-2-6-13(14)10-16/h2-3,6-7,12,15H,4-5,8-9,11H2,1H3/t12-,15?/m0/s1 |
| InChIKey | UNUYPILAAGQLAW-SFVWDYPZSA-N |
| XLogP | 2.87 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |