C15H18N2O4 — CID 94817241
(2S)-2-(2-cyanophenoxy)-N-[(2S)-oxan-2-yl]oxypropanamide (PubChem CID 94817241) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is (2S)-2-(2-cyanophenoxy)-N-[(2S)-oxan-2-yl]oxypropanamide.
| Compound Name | (2S)-2-(2-cyanophenoxy)-N-[(2S)-oxan-2-yl]oxypropanamide |
|---|---|
| PubChem CID | 94817241 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (2S)-2-(2-cyanophenoxy)-N-[(2S)-oxan-2-yl]oxypropanamide |
| SMILES | C[C@H](Oc1ccccc1C#N)C(=O)NO[C@H]1CCCCO1 |
| InChI | InChI=1S/C15H18N2O4/c1-11(20-13-7-3-2-6-12(13)10-16)15(18)17-21-14-8-4-5-9-19-14/h2-3,6-7,11,14H,4-5,8-9H2,1H3,(H,17,18)/t11-,14-/m0/s1 |
| InChIKey | GDKIAGXNSOSHGW-FZMZJTMJSA-N |
| XLogP | 1.90 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|