C12H13N3O4 — CID 112550843
N-(2-amino-2-oxoethoxy)-2-(2-cyanophenoxy)propanamide (PubChem CID 112550843) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-2-(2-cyanophenoxy)propanamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-2-(2-cyanophenoxy)propanamide |
|---|---|
| PubChem CID | 112550843 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-2-(2-cyanophenoxy)propanamide |
| SMILES | CC(Oc1ccccc1C#N)C(=O)NOCC(N)=O |
| InChI | InChI=1S/C12H13N3O4/c1-8(12(17)15-18-7-11(14)16)19-10-5-3-2-4-9(10)6-13/h2-5,8H,7H2,1H3,(H2,14,16)(H,15,17) |
| InChIKey | XYSHEYCSJPCBTM-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|