C11H12N2O4S — CID 47232876
2-(2-cyanophenoxy)-N-methylsulfonylpropanamide (PubChem CID 47232876) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-methylsulfonylpropanamide.
| Compound Name | 2-(2-cyanophenoxy)-N-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 47232876 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-methylsulfonylpropanamide |
| SMILES | CC(Oc1ccccc1C#N)C(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C11H12N2O4S/c1-8(11(14)13-18(2,15)16)17-10-6-4-3-5-9(10)7-12/h3-6,8H,1-2H3,(H,13,14) |
| InChIKey | QRFUXYOPXFATPH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |