C18H18N2O5S — CID 95176209
(2R)-2-(2-cyanophenoxy)-N-(4-methoxy-3-methylphenyl)sulfonylpropanamide (PubChem CID 95176209) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is (2R)-2-(2-cyanophenoxy)-N-(4-methoxy-3-methylphenyl)sulfonylpropanamide.
| Compound Name | (2R)-2-(2-cyanophenoxy)-N-(4-methoxy-3-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 95176209 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | (2R)-2-(2-cyanophenoxy)-N-(4-methoxy-3-methylphenyl)sulfonylpropanamide |
| SMILES | COc1ccc(S(=O)(=O)NC(=O)[C@@H](C)Oc2ccccc2C#N)cc1C |
| InChI | InChI=1S/C18H18N2O5S/c1-12-10-15(8-9-16(12)24-3)26(22,23)20-18(21)13(2)25-17-7-5-4-6-14(17)11-19/h4-10,13H,1-3H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | IZVSNPPFHIMCSC-CYBMUJFWSA-N |
| XLogP | 2.15 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |