C13H15NO2 — CID 103134244
2-[(5-methyloxolan-2-yl)methoxy]benzonitrile (PubChem CID 103134244) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-[(5-methyloxolan-2-yl)methoxy]benzonitrile.
| Compound Name | 2-[(5-methyloxolan-2-yl)methoxy]benzonitrile |
|---|---|
| PubChem CID | 103134244 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 2-[(5-methyloxolan-2-yl)methoxy]benzonitrile |
| SMILES | CC1CCC(COc2ccccc2C#N)O1 |
| InChI | InChI=1S/C13H15NO2/c1-10-6-7-12(16-10)9-15-13-5-3-2-4-11(13)8-14/h2-5,10,12H,6-7,9H2,1H3 |
| InChIKey | VQTYNTUEWHLGSN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |