C13H14FNO2 — CID 103143092
2-fluoro-4-[(5-methyloxolan-2-yl)methoxy]benzonitrile (PubChem CID 103143092) has the molecular formula C13H14FNO2 and a molecular weight of 235.26 g/mol. Its IUPAC name is 2-fluoro-4-[(5-methyloxolan-2-yl)methoxy]benzonitrile.
| Compound Name | 2-fluoro-4-[(5-methyloxolan-2-yl)methoxy]benzonitrile |
|---|---|
| PubChem CID | 103143092 |
| Molecular Formula | C13H14FNO2 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-fluoro-4-[(5-methyloxolan-2-yl)methoxy]benzonitrile |
| SMILES | CC1CCC(COc2ccc(C#N)c(F)c2)O1 |
| InChI | InChI=1S/C13H14FNO2/c1-9-2-4-12(17-9)8-16-11-5-3-10(7-15)13(14)6-11/h3,5-6,9,12H,2,4,8H2,1H3 |
| InChIKey | JOTYNPMIEBSQLD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |