C12H14BF4KO2 — CID 103135581
potassium trifluoro-[2-fluoro-4-[(5-methyloxolan-2-yl)methoxy]phenyl]boranuide (PubChem CID 103135581) has the molecular formula C12H14BF4KO2 and a molecular weight of 316.14 g/mol. Its IUPAC name is potassium trifluoro-[2-fluoro-4-[(5-methyloxolan-2-yl)methoxy]phenyl]boranuide.
| Compound Name | potassium trifluoro-[2-fluoro-4-[(5-methyloxolan-2-yl)methoxy]phenyl]boranuide |
|---|---|
| PubChem CID | 103135581 |
| Molecular Formula | C12H14BF4KO2 |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | potassium trifluoro-[2-fluoro-4-[(5-methyloxolan-2-yl)methoxy]phenyl]boranuide |
| SMILES | CC1CCC(COc2ccc([B-](F)(F)F)c(F)c2)O1.[K+] |
| InChI | InChI=1S/C12H14BF4O2.K/c1-8-2-3-10(19-8)7-18-9-4-5-11(12(14)6-9)13(15,16)17;/h4-6,8,10H,2-3,7H2,1H3;/q-1;+1 |
| InChIKey | UWDTZAAGDQMHHZ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|