C12H14BF4O2- — CID 103135573
trifluoro-[5-fluoro-2-[(5-methyloxolan-2-yl)methoxy]phenyl]boranuide (PubChem CID 103135573) has the molecular formula C12H14BF4O2- and a molecular weight of 277.05 g/mol. Its IUPAC name is trifluoro-[5-fluoro-2-[(5-methyloxolan-2-yl)methoxy]phenyl]boranuide.
| Compound Name | trifluoro-[5-fluoro-2-[(5-methyloxolan-2-yl)methoxy]phenyl]boranuide |
|---|---|
| PubChem CID | 103135573 |
| Molecular Formula | C12H14BF4O2- |
| Molecular Weight | 277.05 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | trifluoro-[5-fluoro-2-[(5-methyloxolan-2-yl)methoxy]phenyl]boranuide |
| SMILES | CC1CCC(COc2ccc(F)cc2[B-](F)(F)F)O1 |
| InChI | InChI=1S/C12H14BF4O2/c1-8-2-4-10(19-8)7-18-12-5-3-9(14)6-11(12)13(15,16)17/h3,5-6,8,10H,2,4,7H2,1H3/q-1 |
| InChIKey | BWZLDJAPVYMCFX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.05 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|