C16H19FO3 — CID 103136463
4-[4-fluoro-2-[(5-methyloxolan-2-yl)methoxy]phenyl]but-3-yn-1-ol (PubChem CID 103136463) has the molecular formula C16H19FO3 and a molecular weight of 278.32 g/mol. Its IUPAC name is 4-[4-fluoro-2-[(5-methyloxolan-2-yl)methoxy]phenyl]but-3-yn-1-ol.
| Compound Name | 4-[4-fluoro-2-[(5-methyloxolan-2-yl)methoxy]phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 103136463 |
| Molecular Formula | C16H19FO3 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-[4-fluoro-2-[(5-methyloxolan-2-yl)methoxy]phenyl]but-3-yn-1-ol |
| SMILES | CC1CCC(COc2cc(F)ccc2C#CCCO)O1 |
| InChI | InChI=1S/C16H19FO3/c1-12-5-8-15(20-12)11-19-16-10-14(17)7-6-13(16)4-2-3-9-18/h6-7,10,12,15,18H,3,5,8-9,11H2,1H3 |
| InChIKey | PCUOAMFKPBCPLD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|