C16H20O3 — CID 54923275
4-[2-(oxan-2-ylmethoxy)phenyl]but-3-yn-1-ol (PubChem CID 54923275) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 4-[2-(oxan-2-ylmethoxy)phenyl]but-3-yn-1-ol.
| Compound Name | 4-[2-(oxan-2-ylmethoxy)phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 54923275 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 4-[2-(oxan-2-ylmethoxy)phenyl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1ccccc1OCC1CCCCO1 |
| InChI | InChI=1S/C16H20O3/c17-11-5-3-8-14-7-1-2-10-16(14)19-13-15-9-4-6-12-18-15/h1-2,7,10,15,17H,4-6,9,11-13H2 |
| InChIKey | XMAFYJHEMXUPFX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|