C14H17F2NO5 — CID 14697180
2-[(2R)-1-(2,3-difluoro-6-nitrophenoxy)propan-2-yl]oxyoxane (PubChem CID 14697180) has the molecular formula C14H17F2NO5 and a molecular weight of 317.29 g/mol. Its IUPAC name is 2-[(2R)-1-(2,3-difluoro-6-nitrophenoxy)propan-2-yl]oxyoxane.
| Compound Name | 2-[(2R)-1-(2,3-difluoro-6-nitrophenoxy)propan-2-yl]oxyoxane |
|---|---|
| PubChem CID | 14697180 |
| Molecular Formula | C14H17F2NO5 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-[(2R)-1-(2,3-difluoro-6-nitrophenoxy)propan-2-yl]oxyoxane |
| SMILES | C[C@H](COc1c([N+](=O)[O-])ccc(F)c1F)OC1CCCCO1 |
| InChI | InChI=1S/C14H17F2NO5/c1-9(22-12-4-2-3-7-20-12)8-21-14-11(17(18)19)6-5-10(15)13(14)16/h5-6,9,12H,2-4,7-8H2,1H3/t9-,12?/m1/s1 |
| InChIKey | MZRIVLOAWMCWBS-PKEIRNPWSA-N |
| XLogP | 3.18 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|