C9H8BrF2NO4 — CID 22247683
1-bromo-3-(2,3-difluoro-6-nitrophenoxy)propan-2-ol (PubChem CID 22247683) has the molecular formula C9H8BrF2NO4 and a molecular weight of 312.07 g/mol. Its IUPAC name is 1-bromo-3-(2,3-difluoro-6-nitrophenoxy)propan-2-ol.
| Compound Name | 1-bromo-3-(2,3-difluoro-6-nitrophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 22247683 |
| Molecular Formula | C9H8BrF2NO4 |
| Molecular Weight | 312.07 g/mol |
| Exact Mass | 310.96 |
| IUPAC Name | 1-bromo-3-(2,3-difluoro-6-nitrophenoxy)propan-2-ol |
| SMILES | O=[N+]([O-])c1ccc(F)c(F)c1OCC(O)CBr |
| InChI | InChI=1S/C9H8BrF2NO4/c10-3-5(14)4-17-9-7(13(15)16)2-1-6(11)8(9)12/h1-2,5,14H,3-4H2 |
| InChIKey | QLZVBKCOSTYTRA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.07 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|