C7H9Br5O2 — CID 18927726
2-(2,2,3,3,3-pentabromopropoxy)oxolane (PubChem CID 18927726) has the molecular formula C7H9Br5O2 and a molecular weight of 524.67 g/mol. Its IUPAC name is 2-(2,2,3,3,3-pentabromopropoxy)oxolane.
| Compound Name | 2-(2,2,3,3,3-pentabromopropoxy)oxolane |
|---|---|
| PubChem CID | 18927726 |
| Molecular Formula | C7H9Br5O2 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 519.65 |
| IUPAC Name | 2-(2,2,3,3,3-pentabromopropoxy)oxolane |
| SMILES | BrC(Br)(Br)C(Br)(Br)COC1CCCO1 |
| InChI | InChI=1S/C7H9Br5O2/c8-6(9,7(10,11)12)4-14-5-2-1-3-13-5/h5H,1-4H2 |
| InChIKey | MQMORAJOSXPNCT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|