C9H13F3O2 — CID 175473604
2-(1,4,4-trifluorobut-2-enoxy)oxane (PubChem CID 175473604) has the molecular formula C9H13F3O2 and a molecular weight of 210.19 g/mol. Its IUPAC name is 2-(1,4,4-trifluorobut-2-enoxy)oxane.
| Compound Name | 2-(1,4,4-trifluorobut-2-enoxy)oxane |
|---|---|
| PubChem CID | 175473604 |
| Molecular Formula | C9H13F3O2 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-(1,4,4-trifluorobut-2-enoxy)oxane |
| SMILES | FC(F)C=CC(F)OC1CCCCO1 |
| InChI | InChI=1S/C9H13F3O2/c10-7(11)4-5-8(12)14-9-3-1-2-6-13-9/h4-5,7-9H,1-3,6H2 |
| InChIKey | KEFRHXICBKMERN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|