C14H22F2O5 — CID 154151752
2,2-difluoro-3,4-bis(oxan-2-yloxy)butanal (PubChem CID 154151752) has the molecular formula C14H22F2O5 and a molecular weight of 308.32 g/mol. Its IUPAC name is 2,2-difluoro-3,4-bis(oxan-2-yloxy)butanal.
| Compound Name | 2,2-difluoro-3,4-bis(oxan-2-yloxy)butanal |
|---|---|
| PubChem CID | 154151752 |
| Molecular Formula | C14H22F2O5 |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2,2-difluoro-3,4-bis(oxan-2-yloxy)butanal |
| SMILES | O=CC(F)(F)C(COC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C14H22F2O5/c15-14(16,10-17)11(21-13-6-2-4-8-19-13)9-20-12-5-1-3-7-18-12/h10-13H,1-9H2 |
| InChIKey | DXIADAFGCAIZTD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|