C14H23F3O3 — CID 85265507
7,7,7-trifluoro-2-methyl-6-(oxan-2-yloxymethyl)hept-2-en-4-ol (PubChem CID 85265507) has the molecular formula C14H23F3O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 7,7,7-trifluoro-2-methyl-6-(oxan-2-yloxymethyl)hept-2-en-4-ol.
| Compound Name | 7,7,7-trifluoro-2-methyl-6-(oxan-2-yloxymethyl)hept-2-en-4-ol |
|---|---|
| PubChem CID | 85265507 |
| Molecular Formula | C14H23F3O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 7,7,7-trifluoro-2-methyl-6-(oxan-2-yloxymethyl)hept-2-en-4-ol |
| SMILES | CC(C)=CC(O)CC(COC1CCCCO1)C(F)(F)F |
| InChI | InChI=1S/C14H23F3O3/c1-10(2)7-12(18)8-11(14(15,16)17)9-20-13-5-3-4-6-19-13/h7,11-13,18H,3-6,8-9H2,1-2H3 |
| InChIKey | AXUWQCANQLSSDE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|