C16H21F3O3 — CID 10495766
2-[(2R)-3,3,3-trifluoro-2-(phenylmethoxymethyl)propoxy]oxane (PubChem CID 10495766) has the molecular formula C16H21F3O3 and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-[(2R)-3,3,3-trifluoro-2-(phenylmethoxymethyl)propoxy]oxane.
| Compound Name | 2-[(2R)-3,3,3-trifluoro-2-(phenylmethoxymethyl)propoxy]oxane |
|---|---|
| PubChem CID | 10495766 |
| Molecular Formula | C16H21F3O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-[(2R)-3,3,3-trifluoro-2-(phenylmethoxymethyl)propoxy]oxane |
| SMILES | FC(F)(F)[C@H](COCc1ccccc1)COC1CCCCO1 |
| InChI | InChI=1S/C16H21F3O3/c17-16(18,19)14(12-22-15-8-4-5-9-21-15)11-20-10-13-6-2-1-3-7-13/h1-3,6-7,14-15H,4-5,8-12H2/t14-,15?/m1/s1 |
| InChIKey | ICKWOEACMSIQBG-GICMACPYSA-N |
| XLogP | 3.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |