C11H19IO2 — CID 10870601
2-[(E,2R)-4-iodo-2-methylpent-3-enoxy]oxane (PubChem CID 10870601) has the molecular formula C11H19IO2 and a molecular weight of 310.18 g/mol. Its IUPAC name is 2-[(E,2R)-4-iodo-2-methylpent-3-enoxy]oxane.
| Compound Name | 2-[(E,2R)-4-iodo-2-methylpent-3-enoxy]oxane |
|---|---|
| PubChem CID | 10870601 |
| Molecular Formula | C11H19IO2 |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-[(E,2R)-4-iodo-2-methylpent-3-enoxy]oxane |
| SMILES | C/C(I)=C\[C@@H](C)COC1CCCCO1 |
| InChI | InChI=1S/C11H19IO2/c1-9(7-10(2)12)8-14-11-5-3-4-6-13-11/h7,9,11H,3-6,8H2,1-2H3/b10-7+/t9-,11?/m1/s1 |
| InChIKey | AMODMRVINYREJO-HJQSHLFPSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|