C69H24O2 — CID 159580205
hexaconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30,32,34,36,38,40,42,44,46,48,50,52,54,56,58-nonacosayne;2-(2-methylpropoxy)oxane (PubChem CID 159580205) has the molecular formula C69H24O2 and a molecular weight of 884.95 g/mol. Its IUPAC name is hexaconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30,32,34,36,38,40,42,44,46,48,50,52,54,56,58-nonacosayne;2-(2-methylpropoxy)oxane.
| Compound Name | hexaconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30,32,34,36,38,40,42,44,46,48,50,52,54,56,58-nonacosayne;2-(2-methylpropoxy)oxane |
|---|---|
| PubChem CID | 159580205 |
| Molecular Formula | C69H24O2 |
| Molecular Weight | 884.95 g/mol |
| Exact Mass | 884.18 |
| IUPAC Name | hexaconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30,32,34,36,38,40,42,44,46,48,50,52,54,56,58-nonacosayne;2-(2-methylpropoxy)oxane |
| SMILES | CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC.CC(C)COC1CCCCO1 |
| InChI | InChI=1S/C60H6.C9H18O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-43-45-47-49-51-53-55-57-59-60-58-56-54-52-50-48-46-44-42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;1-8(2)7-11-9-5-3-4-6-10-9/h1-2H3;8-9H,3-7H2,1-2H3 |
| InChIKey | MIXNWANTVDXUPX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 71 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.95 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|