C11H21BrO2 — CID 14731941
2-(4-bromo-2,3-dimethylbutoxy)oxane (PubChem CID 14731941) has the molecular formula C11H21BrO2 and a molecular weight of 265.19 g/mol. Its IUPAC name is 2-(4-bromo-2,3-dimethylbutoxy)oxane.
| Compound Name | 2-(4-bromo-2,3-dimethylbutoxy)oxane |
|---|---|
| PubChem CID | 14731941 |
| Molecular Formula | C11H21BrO2 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-(4-bromo-2,3-dimethylbutoxy)oxane |
| SMILES | CC(CBr)C(C)COC1CCCCO1 |
| InChI | InChI=1S/C11H21BrO2/c1-9(7-12)10(2)8-14-11-5-3-4-6-13-11/h9-11H,3-8H2,1-2H3 |
| InChIKey | MAXSRMNISOJNAS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|