C15H21F9O2 — CID 18927593
2-(2-butyl-3,3,4,4,5,5,6,6,6-nonafluorohexoxy)oxane (PubChem CID 18927593) has the molecular formula C15H21F9O2 and a molecular weight of 404.31 g/mol. Its IUPAC name is 2-(2-butyl-3,3,4,4,5,5,6,6,6-nonafluorohexoxy)oxane.
| Compound Name | 2-(2-butyl-3,3,4,4,5,5,6,6,6-nonafluorohexoxy)oxane |
|---|---|
| PubChem CID | 18927593 |
| Molecular Formula | C15H21F9O2 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-(2-butyl-3,3,4,4,5,5,6,6,6-nonafluorohexoxy)oxane |
| SMILES | CCCCC(COC1CCCCO1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H21F9O2/c1-2-3-6-10(9-26-11-7-4-5-8-25-11)12(16,17)13(18,19)14(20,21)15(22,23)24/h10-11H,2-9H2,1H3 |
| InChIKey | ZHMWTRCEEMXWHT-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|