C16H25BrF2O2 — CID 146504438
2-[3-(3-bromo-3,3-difluoroprop-1-ynyl)octoxy]oxane (PubChem CID 146504438) has the molecular formula C16H25BrF2O2 and a molecular weight of 367.27 g/mol. Its IUPAC name is 2-[3-(3-bromo-3,3-difluoroprop-1-ynyl)octoxy]oxane.
| Compound Name | 2-[3-(3-bromo-3,3-difluoroprop-1-ynyl)octoxy]oxane |
|---|---|
| PubChem CID | 146504438 |
| Molecular Formula | C16H25BrF2O2 |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-[3-(3-bromo-3,3-difluoroprop-1-ynyl)octoxy]oxane |
| SMILES | CCCCCC(C#CC(F)(F)Br)CCOC1CCCCO1 |
| InChI | InChI=1S/C16H25BrF2O2/c1-2-3-4-7-14(9-11-16(17,18)19)10-13-21-15-8-5-6-12-20-15/h14-15H,2-8,10,12-13H2,1H3 |
| InChIKey | YOMBTYFTARCAOV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|