C15H20O7S — CID 18003674
[2-(1,3-benzodioxol-5-yl)-2-(oxan-2-yloxy)ethyl] methanesulfonate (PubChem CID 18003674) has the molecular formula C15H20O7S and a molecular weight of 344.39 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-2-(oxan-2-yloxy)ethyl] methanesulfonate.
| Compound Name | [2-(1,3-benzodioxol-5-yl)-2-(oxan-2-yloxy)ethyl] methanesulfonate |
|---|---|
| PubChem CID | 18003674 |
| Molecular Formula | C15H20O7S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yl)-2-(oxan-2-yloxy)ethyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCC(OC1CCCCO1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H20O7S/c1-23(16,17)21-9-14(22-15-4-2-3-7-18-15)11-5-6-12-13(8-11)20-10-19-12/h5-6,8,14-15H,2-4,7,9-10H2,1H3 |
| InChIKey | LXJAZGHQWMZQEO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|