C18H20O6 — CID 11221249
[1-(1,3-benzodioxol-5-yl)-4-(oxan-2-yloxy)but-2-ynyl] acetate (PubChem CID 11221249) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-yl)-4-(oxan-2-yloxy)but-2-ynyl] acetate.
| Compound Name | [1-(1,3-benzodioxol-5-yl)-4-(oxan-2-yloxy)but-2-ynyl] acetate |
|---|---|
| PubChem CID | 11221249 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | [1-(1,3-benzodioxol-5-yl)-4-(oxan-2-yloxy)but-2-ynyl] acetate |
| SMILES | CC(=O)OC(C#CCOC1CCCCO1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H20O6/c1-13(19)24-15(5-4-10-21-18-6-2-3-9-20-18)14-7-8-16-17(11-14)23-12-22-16/h7-8,11,15,18H,2-3,6,9-10,12H2,1H3 |
| InChIKey | VOZDTSNLMPBOQG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|