C18H22O6 — CID 10914609
4-(oxan-2-yloxy)-1-(3,4,5-trimethoxyphenyl)but-2-yn-1-one (PubChem CID 10914609) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is 4-(oxan-2-yloxy)-1-(3,4,5-trimethoxyphenyl)but-2-yn-1-one.
| Compound Name | 4-(oxan-2-yloxy)-1-(3,4,5-trimethoxyphenyl)but-2-yn-1-one |
|---|---|
| PubChem CID | 10914609 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-(oxan-2-yloxy)-1-(3,4,5-trimethoxyphenyl)but-2-yn-1-one |
| SMILES | COc1cc(C(=O)C#CCOC2CCCCO2)cc(OC)c1OC |
| InChI | InChI=1S/C18H22O6/c1-20-15-11-13(12-16(21-2)18(15)22-3)14(19)7-6-10-24-17-8-4-5-9-23-17/h11-12,17H,4-5,8-10H2,1-3H3 |
| InChIKey | SIBYYQBVLVIQEW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|