C16H23BrO5 — CID 71733596
2-[[4-(2-bromoethoxy)-3,5-dimethoxyphenyl]methoxy]oxane (PubChem CID 71733596) has the molecular formula C16H23BrO5 and a molecular weight of 375.26 g/mol. Its IUPAC name is 2-[[4-(2-bromoethoxy)-3,5-dimethoxyphenyl]methoxy]oxane.
| Compound Name | 2-[[4-(2-bromoethoxy)-3,5-dimethoxyphenyl]methoxy]oxane |
|---|---|
| PubChem CID | 71733596 |
| Molecular Formula | C16H23BrO5 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 2-[[4-(2-bromoethoxy)-3,5-dimethoxyphenyl]methoxy]oxane |
| SMILES | COc1cc(COC2CCCCO2)cc(OC)c1OCCBr |
| InChI | InChI=1S/C16H23BrO5/c1-18-13-9-12(11-22-15-5-3-4-7-20-15)10-14(19-2)16(13)21-8-6-17/h9-10,15H,3-8,11H2,1-2H3 |
| InChIKey | NYAGCYICMVDBOO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|