C24H30O6 — CID 102211763
2-[[3-methoxy-4-[2-(4-prop-2-enoxyphenoxy)ethoxy]phenyl]methoxy]oxane (PubChem CID 102211763) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is 2-[[3-methoxy-4-[2-(4-prop-2-enoxyphenoxy)ethoxy]phenyl]methoxy]oxane.
| Compound Name | 2-[[3-methoxy-4-[2-(4-prop-2-enoxyphenoxy)ethoxy]phenyl]methoxy]oxane |
|---|---|
| PubChem CID | 102211763 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 2-[[3-methoxy-4-[2-(4-prop-2-enoxyphenoxy)ethoxy]phenyl]methoxy]oxane |
| SMILES | C=CCOc1ccc(OCCOc2ccc(COC3CCCCO3)cc2OC)cc1 |
| InChI | InChI=1S/C24H30O6/c1-3-13-26-20-8-10-21(11-9-20)27-15-16-28-22-12-7-19(17-23(22)25-2)18-30-24-6-4-5-14-29-24/h3,7-12,17,24H,1,4-6,13-16,18H2,2H3 |
| InChIKey | TYUCNMABUPPVRH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|