C21H33NO4 — CID 143437489
2-[3-[4-(cyclobutylidenemethyl)-2-methoxyphenoxy]propoxy]oxane;methanamine (PubChem CID 143437489) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is 2-[3-[4-(cyclobutylidenemethyl)-2-methoxyphenoxy]propoxy]oxane;methanamine.
| Compound Name | 2-[3-[4-(cyclobutylidenemethyl)-2-methoxyphenoxy]propoxy]oxane;methanamine |
|---|---|
| PubChem CID | 143437489 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 2-[3-[4-(cyclobutylidenemethyl)-2-methoxyphenoxy]propoxy]oxane;methanamine |
| SMILES | CN.COc1cc(C=C2CCC2)ccc1OCCCOC1CCCCO1 |
| InChI | InChI=1S/C20H28O4.CH5N/c1-21-19-15-17(14-16-6-4-7-16)9-10-18(19)22-12-5-13-24-20-8-2-3-11-23-20;1-2/h9-10,14-15,20H,2-8,11-13H2,1H3;2H2,1H3 |
| InChIKey | KMMXQCBUJLFFKB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|