C25H27NO6 — CID 177077658
(2Z)-1-acetyl-2-[[3-methoxy-4-[2-(oxan-2-yloxy)ethoxy]phenyl]methylidene]indol-3-one (PubChem CID 177077658) has the molecular formula C25H27NO6 and a molecular weight of 437.49 g/mol. Its IUPAC name is (2Z)-1-acetyl-2-[[3-methoxy-4-[2-(oxan-2-yloxy)ethoxy]phenyl]methylidene]indol-3-one.
| Compound Name | (2Z)-1-acetyl-2-[[3-methoxy-4-[2-(oxan-2-yloxy)ethoxy]phenyl]methylidene]indol-3-one |
|---|---|
| PubChem CID | 177077658 |
| Molecular Formula | C25H27NO6 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (2Z)-1-acetyl-2-[[3-methoxy-4-[2-(oxan-2-yloxy)ethoxy]phenyl]methylidene]indol-3-one |
| SMILES | COc1cc(/C=C2/C(=O)c3ccccc3N2C(C)=O)ccc1OCCOC1CCCCO1 |
| InChI | InChI=1S/C25H27NO6/c1-17(27)26-20-8-4-3-7-19(20)25(28)21(26)15-18-10-11-22(23(16-18)29-2)30-13-14-32-24-9-5-6-12-31-24/h3-4,7-8,10-11,15-16,24H,5-6,9,12-14H2,1-2H3/b21-15- |
| InChIKey | HZTGNAIZXZVCEK-QNGOZBTKSA-N |
| XLogP | 4.21 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|