C14H17ClO5 — CID 146457189
2-chloro-3-[2-(oxan-2-yloxy)ethoxy]benzoic acid (PubChem CID 146457189) has the molecular formula C14H17ClO5 and a molecular weight of 300.74 g/mol. Its IUPAC name is 2-chloro-3-[2-(oxan-2-yloxy)ethoxy]benzoic acid.
| Compound Name | 2-chloro-3-[2-(oxan-2-yloxy)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 146457189 |
| Molecular Formula | C14H17ClO5 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-chloro-3-[2-(oxan-2-yloxy)ethoxy]benzoic acid |
| SMILES | O=C(O)c1cccc(OCCOC2CCCCO2)c1Cl |
| InChI | InChI=1S/C14H17ClO5/c15-13-10(14(16)17)4-3-5-11(13)18-8-9-20-12-6-1-2-7-19-12/h3-5,12H,1-2,6-9H2,(H,16,17) |
| InChIKey | HTZYUYHAFQRRLM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|