C35H54ClN3O9 — CID 160607731
tert-butyl N-[6-[[3-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]oxy]hexyl]carbamate;2-chloro-3-[2-(oxan-2-yloxy)ethoxy]pyridine (PubChem CID 160607731) has the molecular formula C35H54ClN3O9 and a molecular weight of 696.28 g/mol. Its IUPAC name is tert-butyl N-[6-[[3-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]oxy]hexyl]carbamate;2-chloro-3-[2-(oxan-2-yloxy)ethoxy]pyridine.
| Compound Name | tert-butyl N-[6-[[3-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]oxy]hexyl]carbamate;2-chloro-3-[2-(oxan-2-yloxy)ethoxy]pyridine |
|---|---|
| PubChem CID | 160607731 |
| Molecular Formula | C35H54ClN3O9 |
| Molecular Weight | 696.28 g/mol |
| Exact Mass | 695.35 |
| IUPAC Name | tert-butyl N-[6-[[3-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]oxy]hexyl]carbamate;2-chloro-3-[2-(oxan-2-yloxy)ethoxy]pyridine |
| SMILES | CC(C)(C)OC(=O)NCCCCCCOc1ncccc1OCCOC1CCCCO1.Clc1ncccc1OCCOC1CCCCO1 |
| InChI | InChI=1S/C23H38N2O6.C12H16ClNO3/c1-23(2,3)31-22(26)25-13-7-4-5-8-16-30-21-19(11-10-14-24-21)27-17-18-29-20-12-6-9-15-28-20;13-12-10(4-3-6-14-12)15-8-9-17-11-5-1-2-7-16-11/h10-11,14,20H,4-9,12-13,15-18H2,1-3H3,(H,25,26);3-4,6,11H,1-2,5,7-9H2 |
| InChIKey | RFCHFTVZPGIGPI-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.28 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|