C28H48N2O6 — CID 175930994
benzyl N-[5-(oxan-2-yloxy)pentyl]carbamate;5-(oxan-2-yloxy)pentan-1-amine (PubChem CID 175930994) has the molecular formula C28H48N2O6 and a molecular weight of 508.70 g/mol. Its IUPAC name is benzyl N-[5-(oxan-2-yloxy)pentyl]carbamate;5-(oxan-2-yloxy)pentan-1-amine.
| Compound Name | benzyl N-[5-(oxan-2-yloxy)pentyl]carbamate;5-(oxan-2-yloxy)pentan-1-amine |
|---|---|
| PubChem CID | 175930994 |
| Molecular Formula | C28H48N2O6 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.35 |
| IUPAC Name | benzyl N-[5-(oxan-2-yloxy)pentyl]carbamate;5-(oxan-2-yloxy)pentan-1-amine |
| SMILES | NCCCCCOC1CCCCO1.O=C(NCCCCCOC1CCCCO1)OCc1ccccc1 |
| InChI | InChI=1S/C18H27NO4.C10H21NO2/c20-18(23-15-16-9-3-1-4-10-16)19-12-6-2-7-13-21-17-11-5-8-14-22-17;11-7-3-1-4-8-12-10-6-2-5-9-13-10/h1,3-4,9-10,17H,2,5-8,11-15H2,(H,19,20);10H,1-9,11H2 |
| InChIKey | RTCJCYGLHGDGKR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|