C17H25NO6 — CID 59442440
ethyl 2-[5-amino-2-[2-(oxan-2-yloxy)ethoxy]phenoxy]acetate (PubChem CID 59442440) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is ethyl 2-[5-amino-2-[2-(oxan-2-yloxy)ethoxy]phenoxy]acetate.
| Compound Name | ethyl 2-[5-amino-2-[2-(oxan-2-yloxy)ethoxy]phenoxy]acetate |
|---|---|
| PubChem CID | 59442440 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | ethyl 2-[5-amino-2-[2-(oxan-2-yloxy)ethoxy]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(N)ccc1OCCOC1CCCCO1 |
| InChI | InChI=1S/C17H25NO6/c1-2-20-16(19)12-24-15-11-13(18)6-7-14(15)21-9-10-23-17-5-3-4-8-22-17/h6-7,11,17H,2-5,8-10,12,18H2,1H3 |
| InChIKey | IHBCBVPHASLABM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|