C32H48O5 — CID 10940205
3,3-dimethyl-1-[2-methyl-4-[3-[3-methyl-4-[2-(oxan-2-yloxy)ethoxy]phenyl]pentan-3-yl]phenoxy]butan-2-ol (PubChem CID 10940205) has the molecular formula C32H48O5 and a molecular weight of 512.73 g/mol. Its IUPAC name is 3,3-dimethyl-1-[2-methyl-4-[3-[3-methyl-4-[2-(oxan-2-yloxy)ethoxy]phenyl]pentan-3-yl]phenoxy]butan-2-ol.
| Compound Name | 3,3-dimethyl-1-[2-methyl-4-[3-[3-methyl-4-[2-(oxan-2-yloxy)ethoxy]phenyl]pentan-3-yl]phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 10940205 |
| Molecular Formula | C32H48O5 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | 3,3-dimethyl-1-[2-methyl-4-[3-[3-methyl-4-[2-(oxan-2-yloxy)ethoxy]phenyl]pentan-3-yl]phenoxy]butan-2-ol |
| SMILES | CCC(CC)(c1ccc(OCCOC2CCCCO2)c(C)c1)c1ccc(OCC(O)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C32H48O5/c1-8-32(9-2,26-14-16-28(24(4)21-26)37-22-29(33)31(5,6)7)25-13-15-27(23(3)20-25)34-18-19-36-30-12-10-11-17-35-30/h13-16,20-21,29-30,33H,8-12,17-19,22H2,1-7H3 |
| InChIKey | GZEKJSDVHZIGGX-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|