C25H42O6 — CID 70389258
2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]-5-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 70389258) has the molecular formula C25H42O6 and a molecular weight of 438.61 g/mol. Its IUPAC name is 2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]-5-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]-5-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 70389258 |
| Molecular Formula | C25H42O6 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]-5-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCCOCCOCCOC2CCCCO2)c(O)c1 |
| InChI | InChI=1S/C25H42O6/c1-24(2,3)19-25(4,5)20-9-10-22(21(26)18-20)29-16-14-27-12-13-28-15-17-31-23-8-6-7-11-30-23/h9-10,18,23,26H,6-8,11-17,19H2,1-5H3 |
| InChIKey | OVKTWEKBKAFYEK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|