C37H56O9 — CID 19844335
3,3-dimethyl-1-[3-methyl-4,5-bis[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]phenyl]-1-phenylbutan-1-ol (PubChem CID 19844335) has the molecular formula C37H56O9 and a molecular weight of 644.85 g/mol. Its IUPAC name is 3,3-dimethyl-1-[3-methyl-4,5-bis[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]phenyl]-1-phenylbutan-1-ol.
| Compound Name | 3,3-dimethyl-1-[3-methyl-4,5-bis[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]phenyl]-1-phenylbutan-1-ol |
|---|---|
| PubChem CID | 19844335 |
| Molecular Formula | C37H56O9 |
| Molecular Weight | 644.85 g/mol |
| Exact Mass | 644.39 |
| IUPAC Name | 3,3-dimethyl-1-[3-methyl-4,5-bis[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]phenyl]-1-phenylbutan-1-ol |
| SMILES | Cc1cc(C(O)(CC(C)(C)C)c2ccccc2)cc(OCCOCCOC2CCCCO2)c1OCCOCCOC1CCCCO1 |
| InChI | InChI=1S/C37H56O9/c1-29-26-31(37(38,28-36(2,3)4)30-12-6-5-7-13-30)27-32(41-22-18-39-19-23-44-33-14-8-10-16-42-33)35(29)46-25-21-40-20-24-45-34-15-9-11-17-43-34/h5-7,12-13,26-27,33-34,38H,8-11,14-25,28H2,1-4H3 |
| InChIKey | SGAUNHWGBKJLCZ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.85 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|