C31H39NO2 — CID 58184124
CID 58184124 (PubChem CID 58184124) has the molecular formula C31H39NO2 and a molecular weight of 457.66 g/mol.
| Compound Name | CID 58184124 |
|---|---|
| PubChem CID | 58184124 |
| Molecular Formula | C31H39NO2 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | — |
| SMILES | [CH]c1cncc(-c2ccc(C(CC)(CC)c3ccc(OCC(O)C(C)(C)C)c(C)c3)cc2C)c1 |
| InChI | InChI=1S/C31H39NO2/c1-9-31(10-2,25-11-13-27(22(4)16-25)24-15-21(3)18-32-19-24)26-12-14-28(23(5)17-26)34-20-29(33)30(6,7)8/h3,11-19,29,33H,9-10,20H2,1-2,4-8H3 |
| InChIKey | UJOMOZSHPAWGNB-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |