C32H49NO5 — CID 71616935
N-hydroxy-7-[4-[3-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]heptanamide (PubChem CID 71616935) has the molecular formula C32H49NO5 and a molecular weight of 527.75 g/mol. Its IUPAC name is N-hydroxy-7-[4-[3-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]heptanamide.
| Compound Name | N-hydroxy-7-[4-[3-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]heptanamide |
|---|---|
| PubChem CID | 71616935 |
| Molecular Formula | C32H49NO5 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.36 |
| IUPAC Name | N-hydroxy-7-[4-[3-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]heptanamide |
| SMILES | CCC(CC)(c1ccc(OCCCCCCC(=O)NO)c(C)c1)c1ccc(OCC(O)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C32H49NO5/c1-8-32(9-2,26-16-18-28(24(4)21-26)38-22-29(34)31(5,6)7)25-15-17-27(23(3)20-25)37-19-13-11-10-12-14-30(35)33-36/h15-18,20-21,29,34,36H,8-14,19,22H2,1-7H3,(H,33,35) |
| InChIKey | IUWOECDPGLZWQE-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|